Products 17547-09-0

CAS 17547-09-0 is the registry number for Boc-beta-alanine 4-nitrophenyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

(4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 17547-09-0) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: NQNGYJVVBTUENI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2O6
Molecular weight310.30 g/mol
IUPAC name(4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
InChIKeyNQNGYJVVBTUENI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)