CAS 17547-09-0 is the registry number for Boc-beta-alanine 4-nitrophenyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 17547-09-0) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: NQNGYJVVBTUENI-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (4-nitrophenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | NQNGYJVVBTUENI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)