CAS 85546-27-6 appears in our catalog under these names: Boc-d-ala-onp, 95%, (R)-4-Nitrophenyl 2-((tert-butoxycarbonyl)amino)propanoate, 95+%, Boc–D–alanine–4–nitrophenyl Ester. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 1g, 5g, 100mg.
(4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 85546-27-6) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SUHFNHHZORGDFI-SECBINFHSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SUHFNHHZORGDFI-SECBINFHSA-N |
| SMILES | C[C@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)