CAS 24787-87-9 appears in our catalog under these names: Z-Ser-ala-oh, 97%, Z–Ser–Ala–OH, Z-Ser-Ala-OH. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 5000mg, 2000mg, 10000mg.
(2S)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 24787-87-9) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (2S)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: VWPKWOHWTBYMEQ-ONGXEEELSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | VWPKWOHWTBYMEQ-ONGXEEELSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)