CAS 499995-73-2 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)-3-(4-nitrophenyl)propanoic acid, 95%, Boc-β-Phe(4-NO2)-OH 95%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(4-nitrophenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid (CAS 499995-73-2) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid. InChIKey: JLVLDNCAYKCLCI-NSHDSACASA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JLVLDNCAYKCLCI-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)