CAS 501015-23-2 appears in our catalog under these names: Boc-(r)-3-amino-3-(2-nitro-phenyl)-propionic acid, 95%, (R)–3–((tert–Butoxycarbonyl)amino)–3–(2–nitrophenyl)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid (CAS 501015-23-2) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid. InChIKey: SAVFDQXYVJSWEN-SNVBAGLBSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid |
| InChIKey | SAVFDQXYVJSWEN-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)