cas: 696641-73-3 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid, 95%, 95% (CAS 696641-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAX2-100mg |
| cas | 696641-73-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2301.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid (CAS 696641-73-3) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid. InChIKey: FGCXSFRGPCUBPW-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| InChIKey | FGCXSFRGPCUBPW-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)