CAS 54160-63-3 is the registry number for (R)–3–Amino–3–(3,4–dimethoxyphenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(3R)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid (CAS 54160-63-3) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3R)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid. InChIKey: FGCXSFRGPCUBPW-MRVPVSSYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| InChIKey | FGCXSFRGPCUBPW-MRVPVSSYSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)