cas: 501030-96-2 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(4-nitrophenyl)propanoic acid, 98%(HPLC),RG, 98%(HPLC),RG (CAS 501030-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9YF-100mg |
| cas | 501030-96-2 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 2354.00 Pln |
| purity | 98%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(4-nitrophenyl)propanoic acid (CAS 501030-96-2) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (3S)-3-amino-3-(4-nitrophenyl)propanoic acid. InChIKey: JVQPVKJZKRICRR-QMMMGPOBSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JVQPVKJZKRICRR-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)