cas: 135383-60-7 — see every product listed under this CAS number, including other names
(S)-Dolaphenine (hydrochloride), 98.54% (CAS 135383-60-7) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 500 mg, 10mM/1mL, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-78828A-1 g |
| cas | 135383-60-7 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 3287.21 Pln | |
| MedChemExpress | 500 mg | 2037.97 Pln | |
| MedChemExpress | 10mM/1mL | 965.21 Pln | |
| MedChemExpress | 100 mg | 886.26 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.54% |
(1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride (CAS 135383-60-7) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride. InChIKey: XQCUEKANDANWHG-PPHPATTJSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | XQCUEKANDANWHG-PPHPATTJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C2=NC=CS2)N.Cl |
Computed by PubChem (NCBI)