cas: 135383-60-7 — see every product listed under this CAS number, including other names
(S)-Dolaphenine hydrochloride, 98%, 98% (CAS 135383-60-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110CG2-50mg |
| cas | 135383-60-7 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 501.20 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 1288.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride (CAS 135383-60-7) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride. InChIKey: XQCUEKANDANWHG-PPHPATTJSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | XQCUEKANDANWHG-PPHPATTJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C2=NC=CS2)N.Cl |
Computed by PubChem (NCBI)