cas: 58561-04-9 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-methylbutanoate, 99.22% (CAS 58561-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-41048-100 g |
| cas | 58561-04-9 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 454.37 Pln | |
| MedChemExpress | 25 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.22% |
Methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 58561-04-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: XCJLIYKAMLUDGN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | XCJLIYKAMLUDGN-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)