CAS 58561-04-9 appears in our catalog under these names: (S)–Methyl 2–((tert–butoxycarbonyl)amino)–3–methylbutanoate, N-(tert-Butoxycarbonyl)-L-valine Methyl Ester, >95.0%(HPLC)(T), Boc-Val-OMe 97%, N-(TERT-BUTOXYCARBONYL)-L-VALINE METHYL&, (S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-methylbutanoate, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g, 5ML, 50g.
Methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 58561-04-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: XCJLIYKAMLUDGN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | XCJLIYKAMLUDGN-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)