cas: 58561-04-9 — see every product listed under this CAS number, including other names
Boc-Val-OMe, 95% (CAS 58561-04-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222206-5G |
| cas | 58561-04-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 143.72 Pln | |
| Fluorochem | 100g | 320.74 Pln | |
| Fluorochem | 500g | 1341.21 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 58561-04-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: XCJLIYKAMLUDGN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | XCJLIYKAMLUDGN-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)