cas: 1081766-09-7 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride 95+% (CAS 1081766-09-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A255036-50mg |
| cas | 1081766-09-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 542.81 Pln | |
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2244.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A255036 |
Methyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 1081766-09-7) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: SLFXIBKUZFTNJA-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | SLFXIBKUZFTNJA-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)