CAS 59410-89-8 is the registry number for Methyl d-4-chlorophenylglycinate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 59410-89-8) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: SLFXIBKUZFTNJA-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | SLFXIBKUZFTNJA-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)