Products 59410-89-8

CAS 59410-89-8 is the registry number for Methyl d-4-chlorophenylglycinate hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 59410-89-8) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: SLFXIBKUZFTNJA-DDWIOCJRSA-N.

Identity
Molecular formulaC9H11Cl2NO2
Molecular weight236.09 g/mol
IUPAC namemethyl (2R)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride
InChIKeySLFXIBKUZFTNJA-DDWIOCJRSA-N
SMILESCOC(=O)[C@@H](C1=CC=C(C=C1)Cl)N.Cl

Computed by PubChem (NCBI)