cas: 219489-07-3 — see every product listed under this CAS number, including other names
(Z)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 90% mix TBC as stabilizer, 90% mix TBC as stabilizer (CAS 219489-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CPK-100mg |
| cas | 219489-07-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1264.40 Pln |
| purity | 90% mix TBC as stabilizer |
|---|---|
| delivery time | 3 weeks |
2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 219489-07-3) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MRAYNLYCQPAZJN-FPLPWBNLSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MRAYNLYCQPAZJN-FPLPWBNLSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\OCC |
Computed by PubChem (NCBI)