cas: 105838-14-0 — see every product listed under this CAS number, including other names
[[(4-Methylphenyl)sulfonyl]oxy]carbamic acid 1,1-dimethylethyl ester, 98%, 98% (CAS 105838-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WLW-100mg |
| cas | 105838-14-0 |
| size | 100mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 50g | 544.40 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Chemat | 250g | 1442.00 Pln | |
| Chemat | 500g | 2198.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate (CAS 105838-14-0) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate. InChIKey: WZDPZKPHVNFUKB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate |
| InChIKey | WZDPZKPHVNFUKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)