cas: 105838-14-0 — see every product listed under this CAS number, including other names
N-Boc-O-tosyl hydroxylamine, 99.55% (CAS 105838-14-0) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10 g, 5 g, 100 mg, 500 mg, 25 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W000438-1 g |
| cas | 105838-14-0 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 575.11 Pln | |
| MedChemExpress | 10 g | 1174.19 Pln | |
| MedChemExpress | 5 g | 937.34 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 500 mg | 477.59 Pln | |
| MedChemExpress | 25 g | 1703.60 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.55% |
[(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate (CAS 105838-14-0) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate. InChIKey: WZDPZKPHVNFUKB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate |
| InChIKey | WZDPZKPHVNFUKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)