cas: 105838-14-0 — see every product listed under this CAS number, including other names
tert-butyl {[(4-methylphenyl)sulfonyl]oxy}carbamate, 95% (CAS 105838-14-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F375559-1G |
| cas | 105838-14-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 539.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate (CAS 105838-14-0) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate. InChIKey: WZDPZKPHVNFUKB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate |
| InChIKey | WZDPZKPHVNFUKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)