[1,1':3',1''-Terphenyl]-2'-ol, 95%
cas: 2432-11-3 — see every product listed under this CAS number, including other names
[1,1':3',1''-Terphenyl]-2'-ol, 95% (CAS 2432-11-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A394090-1g |
| cas | 2432-11-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1093.50 Pln | |
| Ambeed | 500g | 4447.69 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 369.89 Pln | |
| BLDpharm | 100g | 1169.61 Pln | |
| BLDpharm | 500g | 4362.93 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,6-diphenylphenol (CAS 2432-11-3) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 2,6-diphenylphenol. InChIKey: ATGFTMUSEPZNJD-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2,6-diphenylphenol |
| InChIKey | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)