CAS 57652-74-1 is the registry number for 3,4-Dihydrobenz[a]anthracen-1(2h)-one. Offered by: Chemat. Available pack sizes: 100mg.
3,4-dihydro-2H-benzo[a]anthracen-1-one (CAS 57652-74-1) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 3,4-dihydro-2H-benzo[a]anthracen-1-one. InChIKey: LVBDYVLCOBUBNZ-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 3,4-dihydro-2H-benzo[a]anthracen-1-one |
| InChIKey | LVBDYVLCOBUBNZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C3=CC4=CC=CC=C4C=C3C=C2 |
Computed by PubChem (NCBI)