CAS 6093-03-4 appears in our catalog under these names: (1,1':3',1''-Terphenyl)-4'-ol, 95+%, 2,4-Diphenylphenol, 95%, 2,4–diphenylphenol, 2,4-diphenylphenol, 95%, 95%. Offered by: AmBeed, Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,4-diphenylphenol (CAS 6093-03-4) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 2,4-diphenylphenol. InChIKey: MKRGRCLYQUZXFS-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2,4-diphenylphenol |
| InChIKey | MKRGRCLYQUZXFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)