CAS 5706-06-9 is the registry number for 2-Indanylidene-1-indanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2Z)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one (CAS 5706-06-9) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: (2Z)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one. InChIKey: GDGCNJMFHOCJEH-MSUUIHNZSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | (2Z)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one |
| InChIKey | GDGCNJMFHOCJEH-MSUUIHNZSA-N |
| SMILES | C1C/C(=C/2\CC3=CC=CC=C3C2=O)/C4=CC=CC=C41 |
Computed by PubChem (NCBI)