CAS 28023-86-1 appears in our catalog under these names: (1,1':3',1''-Terphenyl)-5'-ol, 98%, 3,5-Diphenylphenol, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 100mg, 5g, 1g.
3,5-diphenylphenol (CAS 28023-86-1) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 3,5-diphenylphenol. InChIKey: CSYMXGSXCONTDD-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 3,5-diphenylphenol |
| InChIKey | CSYMXGSXCONTDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)