CAS 7530-37-2 is the registry number for 1',3'-Dihydro-[1,2'-biindenylidene]-2(3H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,3-dihydroinden-2-ylidene)-1H-inden-2-one (CAS 7530-37-2) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 3-(1,3-dihydroinden-2-ylidene)-1H-inden-2-one. InChIKey: CMKCIDNECKQVKB-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 3-(1,3-dihydroinden-2-ylidene)-1H-inden-2-one |
| InChIKey | CMKCIDNECKQVKB-UHFFFAOYSA-N |
| SMILES | C1C(=C2C(=O)CC3=CC=CC=C32)CC4=CC=CC=C41 |
Computed by PubChem (NCBI)