Products 2432-11-3
CAS 2432-11-3 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-2'-ol, 95%, [1,1':3',1''-Terphenyl]-2'-ol, 98%, 2,6-Diphenylphenol, >95% (HPLC), 2,6-Diphenylphenol, 2,6-Diphenylphenol, >98.0%(GC). Offered by: Ambeed, Chemat, BLDpharm, TRC, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg, 0,01kg.
2,6-diphenylphenol (CAS 2432-11-3) is a chemical compound with the molecular formula C18H14O and a molecular weight of 246.3 g/mol. IUPAC name: 2,6-diphenylphenol. InChIKey: ATGFTMUSEPZNJD-UHFFFAOYSA-N.
| Molecular formula | C18H14O |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2,6-diphenylphenol |
| InChIKey | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)