[1,1'-Biphenyl]-2,4'-dicarboxylic acid, 95%
cas: 606-80-4 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,4'-dicarboxylic acid, 95% (CAS 606-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A526516-250mg |
| cas | 606-80-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 864.16 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 523.79 Pln | |
| Fluorochem | 5g | 1622.36 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-carboxyphenyl)benzoic acid (CAS 606-80-4) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-(4-carboxyphenyl)benzoic acid. InChIKey: WKSIHEZXQNJQCB-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(4-carboxyphenyl)benzoic acid |
| InChIKey | WKSIHEZXQNJQCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)