CAS 24351-56-2 appears in our catalog under these names: 3-(3,4-Methylenedioxyphenyl)benzoic acid, 95%, 3-(Benzo(d)(1,3)dioxol-5-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
3-(1,3-benzodioxol-5-yl)benzoic acid (CAS 24351-56-2) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)benzoic acid. InChIKey: KMYXCUZMLVHANR-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)benzoic acid |
| InChIKey | KMYXCUZMLVHANR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)