Products 3155-16-6
CAS 3155-16-6 appears in our catalog under these names: Oxalic acid diphenyl ester, 98%, Diphenyl Oxalate, Oxalic acid diphenyl ester, Diphenyl Oxalate, >98.0%(GC), Diphenyl oxalate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 100g, 10g, 500g.
Diphenyl oxalate (CAS 3155-16-6) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: diphenyl oxalate. InChIKey: ULOZDEVJRTYKFE-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | diphenyl oxalate |
| InChIKey | ULOZDEVJRTYKFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)