CAS 743440-23-5 appears in our catalog under these names: (Dibenzo[b,d]furan-2-yloxy)acetic acid, 95%, 2-{8-oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yloxy}acetic acid, 95%, 2-{8-Oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yloxy}acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-dibenzofuran-2-yloxyacetic acid (CAS 743440-23-5) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-dibenzofuran-2-yloxyacetic acid. InChIKey: KLJPFPXXIRGPLF-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-dibenzofuran-2-yloxyacetic acid |
| InChIKey | KLJPFPXXIRGPLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)OCC(=O)O |
Computed by PubChem (NCBI)