CAS 606-75-7 appears in our catalog under these names: Biphenyl-2,3'-dicarboxylic acid, 96%, (1,1'-Biphenyl)-2,3'-dicarboxylic acid, 96%, [1,1'-Biphenyl]-2,3'-dicarboxylic acid, 96%, 96%, [1,1'-Biphenyl]-2,3'-dicarboxylic acid, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-(3-carboxyphenyl)benzoic acid (CAS 606-75-7) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-(3-carboxyphenyl)benzoic acid. InChIKey: OFKNLQSJUCXVRY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(3-carboxyphenyl)benzoic acid |
| InChIKey | OFKNLQSJUCXVRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)