CAS 28547-23-1 appears in our catalog under these names: 4-Benzoyloxybenzoic acid, 95%, Para-Benzoyloxybenzoic Acid, 4-Benzoyloxybenzoic acid. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 10g, 500mg, 1000mg.
4-benzoyloxybenzoic acid (CAS 28547-23-1) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 4-benzoyloxybenzoic acid. InChIKey: OUANAAHOQVMJCH-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 4-benzoyloxybenzoic acid |
| InChIKey | OUANAAHOQVMJCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)