CAS 33288-79-8 appears in our catalog under these names: 4,4'-Dihydroxybenzil, 95%, 1,2–Bis(4–hydroxyphenyl)ethane–1,2–dione, 1,2-Bis(4-hydroxyphenyl)ethane-1,2-dione, 98%, 98%, 1,2-Bis(4-hydroxyphenyl)ethane-1,2-dione, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g, 100g.
1,2-bis(4-hydroxyphenyl)ethane-1,2-dione (CAS 33288-79-8) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 1,2-bis(4-hydroxyphenyl)ethane-1,2-dione. InChIKey: FMYXOBBPXQZKKY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1,2-bis(4-hydroxyphenyl)ethane-1,2-dione |
| InChIKey | FMYXOBBPXQZKKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)