cas: 1909335-91-6 — see every product listed under this CAS number, including other names
[1-(2,6-Difluorophenyl)cyclobutyl]methanamine hydrochloride (CAS 1909335-91-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C41W-50mg |
| cas | 1909335-91-6 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 242.00 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1542.80 Pln |
| delivery time | 3 weeks |
|---|
[1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride (CAS 1909335-91-6) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: [1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride. InChIKey: RAOVYBJHTVUHBA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | [1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride |
| InChIKey | RAOVYBJHTVUHBA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)