CAS 2256054-78-9 is the registry number for (S)-2-(3,5-Difluorophenyl)piperidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,5-difluorophenyl)piperidine;hydrochloride (CAS 2256054-78-9) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: (2S)-2-(3,5-difluorophenyl)piperidine;hydrochloride. InChIKey: KSFLWCHHRHMYGP-MERQFXBCSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | (2S)-2-(3,5-difluorophenyl)piperidine;hydrochloride |
| InChIKey | KSFLWCHHRHMYGP-MERQFXBCSA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)