CAS 2569698-47-9 is the registry number for (R)-1-(1,1-Difluoro-2,3-dihydro-1H-inden-4-yl)ethan-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanamine;hydrochloride (CAS 2569698-47-9) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: (1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanamine;hydrochloride. InChIKey: GGOGEIVTHKKOGR-OGFXRTJISA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | (1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanamine;hydrochloride |
| InChIKey | GGOGEIVTHKKOGR-OGFXRTJISA-N |
| SMILES | C[C@H](C1=C2CCC(C2=CC=C1)(F)F)N.Cl |
Computed by PubChem (NCBI)