CAS 1864062-82-7 is the registry number for Cyclobutyl(3,4-difluorophenyl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclobutyl-(3,4-difluorophenyl)methanamine;hydrochloride (CAS 1864062-82-7) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: cyclobutyl-(3,4-difluorophenyl)methanamine;hydrochloride. InChIKey: ISSVWVODUYPMOU-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | cyclobutyl-(3,4-difluorophenyl)methanamine;hydrochloride |
| InChIKey | ISSVWVODUYPMOU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=CC(=C(C=C2)F)F)N.Cl |
Computed by PubChem (NCBI)