cas: 1401425-69-1 — see every product listed under this CAS number, including other names
[3-(1-METHYL-1H-IMIDAZOL-2-YL)PHENYL]AMINE DIHYDROCHLORIDE, 97%, 97% (CAS 1401425-69-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVR7-100mg |
| cas | 1401425-69-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1379.60 Pln | |
| Chemat | 5g | 5334.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(1-methylimidazol-2-yl)aniline;dihydrochloride (CAS 1401425-69-1) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: 3-(1-methylimidazol-2-yl)aniline;dihydrochloride. InChIKey: PQZVXVXSEOZELR-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-(1-methylimidazol-2-yl)aniline;dihydrochloride |
| InChIKey | PQZVXVXSEOZELR-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)