CAS 1185298-57-0 appears in our catalog under these names: [3-(1H-Pyrazol-1-yl)benzyl]amine dihydrochloride, 95%, (3-(1H-Pyrazol-1-yl)benzyl)aminedihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
(3-pyrazol-1-ylphenyl)methanamine;dihydrochloride (CAS 1185298-57-0) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: (3-pyrazol-1-ylphenyl)methanamine;dihydrochloride. InChIKey: SGXHALBNLDWWKE-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | (3-pyrazol-1-ylphenyl)methanamine;dihydrochloride |
| InChIKey | SGXHALBNLDWWKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)