Products 1258640-58-2

CAS 1258640-58-2 is the registry number for 3-Methyl-1-phenyl-1h-pyrazol-5-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

5-methyl-2-phenylpyrazol-3-amine;dihydrochloride (CAS 1258640-58-2) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: 5-methyl-2-phenylpyrazol-3-amine;dihydrochloride. InChIKey: OTVAWGYLEFOURH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13Cl2N3
Molecular weight246.13 g/mol
IUPAC name5-methyl-2-phenylpyrazol-3-amine;dihydrochloride
InChIKeyOTVAWGYLEFOURH-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)N)C2=CC=CC=C2.Cl.Cl

Computed by PubChem (NCBI)