CAS 2288710-59-6 appears in our catalog under these names: N-(3-Chloropropyl)-1H-1,3-benzodiazol-2-amine hydrochloride, 96%, N-(3-Chloropropyl)-1H-benzo(d)imidazol-2-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
N-(3-chloropropyl)-1H-benzimidazol-2-amine;hydrochloride (CAS 2288710-59-6) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: N-(3-chloropropyl)-1H-benzimidazol-2-amine;hydrochloride. InChIKey: RWXJYOQAFGANML-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | N-(3-chloropropyl)-1H-benzimidazol-2-amine;hydrochloride |
| InChIKey | RWXJYOQAFGANML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)NCCCCl.Cl |
Computed by PubChem (NCBI)