CAS 1431966-12-9 appears in our catalog under these names: (4-(1H-Imidazol-1-yl)phenyl)methanamine dihydrochloride, 97%, (4-(1H-Imidazol-1-yl)phenyl)methanamine dihydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50mg, 250mg.
(4-imidazol-1-ylphenyl)methanamine;dihydrochloride (CAS 1431966-12-9) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: (4-imidazol-1-ylphenyl)methanamine;dihydrochloride. InChIKey: FOFRAVUBYRGMOP-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | (4-imidazol-1-ylphenyl)methanamine;dihydrochloride |
| InChIKey | FOFRAVUBYRGMOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2C=CN=C2.Cl.Cl |
Computed by PubChem (NCBI)