CAS 1401425-69-1 appears in our catalog under these names: [3-(1-Methyl-1h-imidazol-2-yl)phenyl]amine dihydrochloride, 95%, 3-(1-Methyl-1H-imidazol-2-yl)aniline dihydrochloride 97%, [3-(1-METHYL-1H-IMIDAZOL-2-YL)PHENYL]AMINE DIHYDROCHLORIDE, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
3-(1-methylimidazol-2-yl)aniline;dihydrochloride (CAS 1401425-69-1) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: 3-(1-methylimidazol-2-yl)aniline;dihydrochloride. InChIKey: PQZVXVXSEOZELR-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-(1-methylimidazol-2-yl)aniline;dihydrochloride |
| InChIKey | PQZVXVXSEOZELR-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)