CAS 1227954-77-9 is the registry number for N-[(6-Chloroimidazo[1,2-a]pyridin-3-yl)methyl]-n,n-dimethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine;hydrochloride (CAS 1227954-77-9) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine;hydrochloride. InChIKey: SWKGTRDZOXYLDQ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | SWKGTRDZOXYLDQ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CN=C2N1C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)