cas: 1195901-44-0 — see every product listed under this CAS number, including other names
[3-(4-FLUOROPHENYL)PHENYL]METHYLAMINEHCL, 98% (CAS 1195901-44-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306088-250MG |
| cas | 1195901-44-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 1044.44 Pln | |
| Fluorochem | 2.5g | 2528.29 Pln | |
| Fluorochem | 5g | 3637.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-(4-fluorophenyl)phenyl]methanamine;hydrochloride (CAS 1195901-44-0) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: [3-(4-fluorophenyl)phenyl]methanamine;hydrochloride. InChIKey: ZYGOVJWOSPPYEB-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | [3-(4-fluorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | ZYGOVJWOSPPYEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)F)CN.Cl |
Computed by PubChem (NCBI)