CAS 1343392-03-9 appears in our catalog under these names: 4-Chloro-8-fluoro-3-isopropyl-2-methylquinoline, 98%, 4-Chloro-8-fluoro-2-methyl-3-(propan-2-yl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
4-chloro-8-fluoro-2-methyl-3-propan-2-ylquinoline (CAS 1343392-03-9) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: 4-chloro-8-fluoro-2-methyl-3-propan-2-ylquinoline. InChIKey: RDFHWVKIABBZEX-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | 4-chloro-8-fluoro-2-methyl-3-propan-2-ylquinoline |
| InChIKey | RDFHWVKIABBZEX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C=CC=C(C2=N1)F)Cl)C(C)C |
Computed by PubChem (NCBI)