Products 944352-60-7
CAS 944352-60-7 is the registry number for 1-(3-Chloro-4-fluorophenyl)cyclohexanecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-chloro-4-fluorophenyl)cyclohexane-1-carbonitrile (CAS 944352-60-7) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)cyclohexane-1-carbonitrile. InChIKey: SCJFDYGODNDGQL-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)cyclohexane-1-carbonitrile |
| InChIKey | SCJFDYGODNDGQL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)