CAS 1189729-43-8 appears in our catalog under these names: 2-(4-Fluorophenyl)benzylamine hydrochloride, 98%, (4'–Fluoro–(1,1'–biphenyl)–2–yl)methanamine hydrochloride, 2-(4-Fluorophenyl)benzylamine, HCl, [2-(4-FLUOROPHENYL)BENZYLAMINE HCL, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
[2-(4-fluorophenyl)phenyl]methanamine;hydrochloride (CAS 1189729-43-8) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: [2-(4-fluorophenyl)phenyl]methanamine;hydrochloride. InChIKey: HQPHXUJGWSXSRC-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | [2-(4-fluorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | HQPHXUJGWSXSRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)