CAS 49703-58-4 appears in our catalog under these names: (4–Fluorophenyl)(phenyl)methanamine hydrochloride, (4-Fluorophenyl)(phenyl)methanamine hydrochloride, 97%, (4-Fluorophenyl)(phenyl)methanamine hydrochloride, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-fluorophenyl)-phenylmethanamine;hydrochloride (CAS 49703-58-4) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: (4-fluorophenyl)-phenylmethanamine;hydrochloride. InChIKey: VYDDTTCGUSKBOE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | (4-fluorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | VYDDTTCGUSKBOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)