Products 856627-88-8
CAS 856627-88-8 is the registry number for N-Benzyl-4-fluoroaniline Hydrochloride. Offered by: TRC. Available pack sizes: 5g.
N-benzyl-4-fluoroaniline;hydrochloride (CAS 856627-88-8) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: N-benzyl-4-fluoroaniline;hydrochloride. InChIKey: HFJJXNYCSVVANP-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | N-benzyl-4-fluoroaniline;hydrochloride |
| InChIKey | HFJJXNYCSVVANP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)